About 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine
1-tert-butylpyrrolo[2,3-c]pyridin-7-amine (PubChem CID 169302613) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine.
Molecular Properties
| Compound Name | 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine |
| PubChem CID | 169302613 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine |
| SMILES | CC(C)(C)n1ccc2ccnc(N)c21 |
| InChI | InChI=1S/C11H15N3/c1-11(2,3)14-7-5-8-4-6-13-10(12)9(8)14/h4-7H,1-3H3,(H2,12,13) |
| InChIKey | LLDJYPSHIYEBPC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine?
The IUPAC name of 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine (CID 169302613) is 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine.
What is the SMILES notation for 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine?
The canonical SMILES for 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine is CC(C)(C)n1ccc2ccnc(N)c21.
What is the InChIKey of 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine?
The InChIKey is LLDJYPSHIYEBPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-11(2,3)14-7-5-8-4-6-13-10(12)9(8)14/h4-7H,1-3H3,(H2,12,13).
What are the key properties of 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine?
1-tert-butylpyrrolo[2,3-c]pyridin-7-amine has a molecular weight of 189.26 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylpyrrolo[2,3-c]pyridin-7-amine is sourced from PubChem (CID 169302613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).