C11H12F4N2O — CID 169302921
N-(2,3,5,6-tetrafluoro-4-pyridinyl)hexanamide (PubChem CID 169302921) has the molecular formula C11H12F4N2O and a molecular weight of 264.22 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluoro-4-pyridinyl)hexanamide.
| Compound Name | N-(2,3,5,6-tetrafluoro-4-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 169302921 |
| Molecular Formula | C11H12F4N2O |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-(2,3,5,6-tetrafluoro-4-pyridinyl)hexanamide |
| SMILES | CCCCCC(=O)Nc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C11H12F4N2O/c1-2-3-4-5-6(18)16-9-7(12)10(14)17-11(15)8(9)13/h2-5H2,1H3,(H,16,17,18) |
| InChIKey | CXAFHILZBREMES-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|