C19H26O — CID 169302964
1-[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-2-(3,5-dimethylphenyl)ethanone (PubChem CID 169302964) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-2-(3,5-dimethylphenyl)ethanone.
| Compound Name | 1-[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-2-(3,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 169302964 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 1-[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-2-(3,5-dimethylphenyl)ethanone |
| SMILES | CC(C)=C[C@@H]1[C@@H](C(=O)Cc2cc(C)cc(C)c2)C1(C)C |
| InChI | InChI=1S/C19H26O/c1-12(2)7-16-18(19(16,5)6)17(20)11-15-9-13(3)8-14(4)10-15/h7-10,16,18H,11H2,1-6H3/t16-,18+/m1/s1 |
| InChIKey | KQULEBRASUOYRC-AEFFLSMTSA-N |
| XLogP | 4.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|