C31H32FNO4 — CID 169303397
4-[5-butoxy-1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-3-yl]benzoic acid (PubChem CID 169303397) has the molecular formula C31H32FNO4 and a molecular weight of 501.60 g/mol. Its IUPAC name is 4-[5-butoxy-1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-3-yl]benzoic acid.
| Compound Name | 4-[5-butoxy-1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 169303397 |
| Molecular Formula | C31H32FNO4 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 4-[5-butoxy-1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-3-yl]benzoic acid |
| SMILES | CCCCOc1ccc2c(c1)c(-c1ccc(C(=O)O)cc1)c(C1CCOCC1)n2-c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C31H32FNO4/c1-3-4-15-37-25-10-12-28-26(19-25)29(21-5-7-23(8-6-21)31(34)35)30(22-13-16-36-17-14-22)33(28)24-9-11-27(32)20(2)18-24/h5-12,18-19,22H,3-4,13-17H2,1-2H3,(H,34,35) |
| InChIKey | WJMQBLUUEJKMKZ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|