C15H21BN2 — CID 169304570
CID 169304570 (PubChem CID 169304570) has the molecular formula C15H21BN2 and a molecular weight of 240.16 g/mol.
| Compound Name | CID 169304570 |
|---|---|
| PubChem CID | 169304570 |
| Molecular Formula | C15H21BN2 |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(CC(C)N)cn(CC(C)C)c2c1 |
| InChI | InChI=1S/C15H21BN2/c1-10(2)8-18-9-12(6-11(3)17)14-5-4-13(16)7-15(14)18/h4-5,7,9-11H,6,8,17H2,1-3H3 |
| InChIKey | LOIBNNNYLOMSRN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|