About US20230339978, Example 2
US20230339978, Example 2 (PubChem CID 169305669) has the molecular formula C18H13ClFN5O
and a molecular weight of 369.80 g/mol. Its IUPAC name is cis-(1S,2S)-N-[5-(4-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | US20230339978, Example 2 |
| PubChem CID | 169305669 |
| Molecular Formula | C18H13ClFN5O |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | cis-(1S,2S)-N-[5-(4-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide |
| SMILES | C1[C@H]([C@H]1F)C(=O)NC2=NN3C=CC(=CC3=C2)C4=CN=C5C(=C4Cl)C=CN5 |
| InChI | InChI=1S/C18H13ClFN5O/c19-16-11-1-3-21-17(11)22-8-13(16)9-2-4-25-10(5-9)6-15(24-25)23-18(26)12-7-14(12)20/h1-6,8,12,14H,7H2,(H,21,22)(H,23,24,26)/t12-,14+/m1/s1 |
| InChIKey | PELIWNRKLAFPFO-OCCSQVGLSA-N |
| XLogP | 2.70 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | 568 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze US20230339978, Example 2 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US20230339978, Example 2?
The IUPAC name of US20230339978, Example 2 (CID 169305669) is cis-(1S,2S)-N-[5-(4-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide.
What is the SMILES notation for US20230339978, Example 2?
The canonical SMILES for US20230339978, Example 2 is C1[C@H]([C@H]1F)C(=O)NC2=NN3C=CC(=CC3=C2)C4=CN=C5C(=C4Cl)C=CN5.
What is the InChIKey of US20230339978, Example 2?
The InChIKey is PELIWNRKLAFPFO-OCCSQVGLSA-N. The full InChI is InChI=1S/C18H13ClFN5O/c19-16-11-1-3-21-17(11)22-8-13(16)9-2-4-25-10(5-9)6-15(24-25)23-18(26)12-7-14(12)20/h1-6,8,12,14H,7H2,(H,21,22)(H,23,24,26)/t12-,14+/m1/s1.
What are the key properties of US20230339978, Example 2?
US20230339978, Example 2 has a molecular weight of 369.80 g/mol, XLogP of 2.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for US20230339978, Example 2 is sourced from PubChem (CID 169305669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).