C19H14F2N6 — CID 169306104
(2S,4R)-8-(5-fluoro-1H-pyrazolo[3,4-b]pyridin-4-yl)-9-(5-fluoro-2-pyridinyl)-1,10-diazatricyclo[5.3.0.02,4]deca-7,9-diene (PubChem CID 169306104) has the molecular formula C19H14F2N6 and a molecular weight of 364.36 g/mol. Its IUPAC name is (2S,4R)-8-(5-fluoro-1H-pyrazolo[3,4-b]pyridin-4-yl)-9-(5-fluoro-2-pyridinyl)-1,10-diazatricyclo[5.3.0.02,4]deca-7,9-diene.
| Compound Name | (2S,4R)-8-(5-fluoro-1H-pyrazolo[3,4-b]pyridin-4-yl)-9-(5-fluoro-2-pyridinyl)-1,10-diazatricyclo[5.3.0.02,4]deca-7,9-diene |
|---|---|
| PubChem CID | 169306104 |
| Molecular Formula | C19H14F2N6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2S,4R)-8-(5-fluoro-1H-pyrazolo[3,4-b]pyridin-4-yl)-9-(5-fluoro-2-pyridinyl)-1,10-diazatricyclo[5.3.0.02,4]deca-7,9-diene |
| SMILES | Fc1ccc(-c2nn3c(c2-c2c(F)cnc4[nH]ncc24)CC[C@@H]2C[C@@H]23)nc1 |
| InChI | InChI=1S/C19H14F2N6/c20-10-2-3-13(22-6-10)18-17(14-4-1-9-5-15(9)27(14)26-18)16-11-7-24-25-19(11)23-8-12(16)21/h2-3,6-9,15H,1,4-5H2,(H,23,24,25)/t9-,15+/m1/s1 |
| InChIKey | GHIKJWQWZXBFJJ-PSLIRLAXSA-N |
| XLogP | 3.67 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |