C30H42N6OS2 — CID 169306287
5-[[2-[[4-(dibutylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]methylidene]-1,3-dipropyl-1,3-diazinan-2-one (PubChem CID 169306287) has the molecular formula C30H42N6OS2 and a molecular weight of 566.84 g/mol. Its IUPAC name is 5-[[2-[[4-(dibutylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]methylidene]-1,3-dipropyl-1,3-diazinan-2-one.
| Compound Name | 5-[[2-[[4-(dibutylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]methylidene]-1,3-dipropyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 169306287 |
| Molecular Formula | C30H42N6OS2 |
| Molecular Weight | 566.84 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 5-[[2-[[4-(dibutylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]methylidene]-1,3-dipropyl-1,3-diazinan-2-one |
| SMILES | CCCCN(CCCC)c1ccc(/N=N/c2nc3sc(C=C4CN(CCC)C(=O)N(CCC)C4)cc3s2)cc1 |
| InChI | InChI=1S/C30H42N6OS2/c1-5-9-17-34(18-10-6-2)25-13-11-24(12-14-25)32-33-29-31-28-27(39-29)20-26(38-28)19-23-21-35(15-7-3)30(37)36(22-23)16-8-4/h11-14,19-20H,5-10,15-18,21-22H2,1-4H3/b33-32+ |
| InChIKey | RFBWXYYXMCZVLU-ULIFNZDWSA-N |
| XLogP | 9.12 |
| TPSA | 64.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.84 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|