C25H26FN3O3 — CID 169306310
(10S,15R)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4,10-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-2,3-dione (PubChem CID 169306310) has the molecular formula C25H26FN3O3 and a molecular weight of 435.50 g/mol. Its IUPAC name is (10S,15R)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4,10-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-2,3-dione.
| Compound Name | (10S,15R)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4,10-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-2,3-dione |
|---|---|
| PubChem CID | 169306310 |
| Molecular Formula | C25H26FN3O3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (10S,15R)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4,10-dimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-2,3-dione |
| SMILES | Cn1c(=O)c(=O)n2c3c(cccc31)[C@@]1(C)CN(CCCC(=O)c3ccc(F)cc3)CC[C@@H]21 |
| InChI | InChI=1S/C25H26FN3O3/c1-25-15-28(13-4-7-20(30)16-8-10-17(26)11-9-16)14-12-21(25)29-22-18(25)5-3-6-19(22)27(2)23(31)24(29)32/h3,5-6,8-11,21H,4,7,12-15H2,1-2H3/t21-,25-/m1/s1 |
| InChIKey | AGBVXKXVWZNIJD-PXDATVDWSA-N |
| XLogP | 3.02 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|