About 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid
2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid (PubChem CID 169306345) has the molecular formula C33H24O6
and a molecular weight of 516.55 g/mol. Its IUPAC name is 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid |
| PubChem CID | 169306345 |
| Molecular Formula | C33H24O6 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid |
| SMILES | O=COC(C(=O)O)(c1ccc2c(c1)C=C(c1ccc(O)cc1)C2)c1ccc2c(c1)C=C(c1ccc(O)cc1)C2 |
| InChI | InChI=1S/C33H24O6/c34-19-39-33(32(37)38,28-7-1-22-13-24(15-26(22)17-28)20-3-9-30(35)10-4-20)29-8-2-23-14-25(16-27(23)18-29)21-5-11-31(36)12-6-21/h1-12,15-19,35-36H,13-14H2,(H,37,38) |
| InChIKey | WIGQASBPVDZNQE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid?
The IUPAC name of 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid (CID 169306345) is 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid.
What is the SMILES notation for 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid?
The canonical SMILES for 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid is O=COC(C(=O)O)(c1ccc2c(c1)C=C(c1ccc(O)cc1)C2)c1ccc2c(c1)C=C(c1ccc(O)cc1)C2.
What is the InChIKey of 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid?
The InChIKey is WIGQASBPVDZNQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H24O6/c34-19-39-33(32(37)38,28-7-1-22-13-24(15-26(22)17-28)20-3-9-30(35)10-4-20)29-8-2-23-14-25(16-27(23)18-29)21-5-11-31(36)12-6-21/h1-12,15-19,35-36H,13-14H2,(H,37,38).
What are the key properties of 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid?
2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid has a molecular weight of 516.55 g/mol, XLogP of 5.79, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formyloxy-2,2-bis[2-(4-hydroxyphenyl)-1H-inden-5-yl]acetic acid is sourced from PubChem (CID 169306345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).