C20H15BrN4O2 — CID 169309374
2-bromo-4-methoxy-N-(1-phenylimidazo[4,5-b]pyridin-2-yl)benzamide (PubChem CID 169309374) has the molecular formula C20H15BrN4O2 and a molecular weight of 423.27 g/mol. Its IUPAC name is 2-bromo-4-methoxy-N-(1-phenylimidazo[4,5-b]pyridin-2-yl)benzamide.
| Compound Name | 2-bromo-4-methoxy-N-(1-phenylimidazo[4,5-b]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 169309374 |
| Molecular Formula | C20H15BrN4O2 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 2-bromo-4-methoxy-N-(1-phenylimidazo[4,5-b]pyridin-2-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2nc3ncccc3n2-c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C20H15BrN4O2/c1-27-14-9-10-15(16(21)12-14)19(26)24-20-23-18-17(8-5-11-22-18)25(20)13-6-3-2-4-7-13/h2-12H,1H3,(H,22,23,24,26) |
| InChIKey | QYUMKGCGFXPJBS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |