C32H32FN5O5 — CID 169310974
benzyl N-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]phenyl]carbamate (PubChem CID 169310974) has the molecular formula C32H32FN5O5 and a molecular weight of 585.64 g/mol. Its IUPAC name is benzyl N-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]phenyl]carbamate.
| Compound Name | benzyl N-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 169310974 |
| Molecular Formula | C32H32FN5O5 |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | benzyl N-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]methyl]phenyl]carbamate |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3N3CCN(Cc4ccc(NC(=O)OCc5ccccc5)cc4)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H32FN5O5/c33-23-16-25-26(19-38(31(25)41)27-10-11-29(39)35-30(27)40)28(17-23)37-14-12-36(13-15-37)18-21-6-8-24(9-7-21)34-32(42)43-20-22-4-2-1-3-5-22/h1-9,16-17,27H,10-15,18-20H2,(H,34,42)(H,35,39,40) |
| InChIKey | RFYNAUSDGLBSSI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|