C28H40ClNO — CID 169311965
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-(6-chloro-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169311965) has the molecular formula C28H40ClNO and a molecular weight of 442.09 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-(6-chloro-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-(6-chloro-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169311965 |
| Molecular Formula | C28H40ClNO |
| Molecular Weight | 442.09 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-(6-chloro-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCc1cccc(Cl)n1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H40ClNO/c1-18(7-9-20-5-4-6-26(29)30-20)23-11-12-24-22-10-8-19-17-21(31)13-15-27(19,2)25(22)14-16-28(23,24)3/h4-6,8,18,21-25,31H,7,9-17H2,1-3H3/t18-,21+,22+,23-,24+,25+,27+,28-/m1/s1 |
| InChIKey | DSLUKIMSJXCTOX-JBZGATTQSA-N |
| XLogP | 7.24 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.09 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|