C31H47NO2 — CID 169312009
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-[3-(2-hydroxypropan-2-yl)-2-pyridinyl]butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169312009) has the molecular formula C31H47NO2 and a molecular weight of 465.72 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-[3-(2-hydroxypropan-2-yl)-2-pyridinyl]butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-[3-(2-hydroxypropan-2-yl)-2-pyridinyl]butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169312009 |
| Molecular Formula | C31H47NO2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-[3-(2-hydroxypropan-2-yl)-2-pyridinyl]butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCc1ncccc1C(C)(C)O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H47NO2/c1-20(8-13-28-27(29(2,3)34)7-6-18-32-28)24-11-12-25-23-10-9-21-19-22(33)14-16-30(21,4)26(23)15-17-31(24,25)5/h6-7,9,18,20,22-26,33-34H,8,10-17,19H2,1-5H3/t20-,22+,23+,24-,25+,26+,30+,31-/m1/s1 |
| InChIKey | OGIATJNVLIWGCR-HCJGDWAISA-N |
| XLogP | 6.82 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|