C18H24N2O2S — CID 16931216
N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-2-(4-ethylphenoxy)acetamide (PubChem CID 16931216) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-2-(4-ethylphenoxy)acetamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-2-(4-ethylphenoxy)acetamide |
|---|---|
| PubChem CID | 16931216 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-2-(4-ethylphenoxy)acetamide |
| SMILES | CCc1ccc(OCC(=O)NCC(c2ccsc2)N(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O2S/c1-4-14-5-7-16(8-6-14)22-12-18(21)19-11-17(20(2)3)15-9-10-23-13-15/h5-10,13,17H,4,11-12H2,1-3H3,(H,19,21) |
| InChIKey | GTZBLYBTIRGILQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |