C33H49N3O2 — CID 169312448
(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-1-one (PubChem CID 169312448) has the molecular formula C33H49N3O2 and a molecular weight of 519.77 g/mol. Its IUPAC name is (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-1-one.
| Compound Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 169312448 |
| Molecular Formula | C33H49N3O2 |
| Molecular Weight | 519.77 g/mol |
| Exact Mass | 519.38 |
| IUPAC Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-1-one |
| SMILES | C[C@H](CCC(=O)N1CCN(c2ccccn2)CC1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H49N3O2/c1-23(7-12-31(38)36-20-18-35(19-21-36)30-6-4-5-17-34-30)27-10-11-28-26-9-8-24-22-25(37)13-15-32(24,2)29(26)14-16-33(27,28)3/h4-6,8,17,23,25-29,37H,7,9-16,18-22H2,1-3H3/t23-,25+,26+,27-,28+,29+,32+,33-/m1/s1 |
| InChIKey | YPDZZGTWIGIMJD-ACBDEFBISA-N |
| XLogP | 6.09 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.77 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|