C29H40F3NO — CID 169312679
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-4-[3-(trifluoromethyl)-2-pyridinyl]butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169312679) has the molecular formula C29H40F3NO and a molecular weight of 475.64 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-4-[3-(trifluoromethyl)-2-pyridinyl]butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-4-[3-(trifluoromethyl)-2-pyridinyl]butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169312679 |
| Molecular Formula | C29H40F3NO |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-4-[3-(trifluoromethyl)-2-pyridinyl]butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCc1ncccc1C(F)(F)F)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H40F3NO/c1-18(6-11-26-25(29(30,31)32)5-4-16-33-26)22-9-10-23-21-8-7-19-17-20(34)12-14-27(19,2)24(21)13-15-28(22,23)3/h4-5,7,16,18,20-24,34H,6,8-15,17H2,1-3H3/t18-,20+,21+,22-,23+,24+,27+,28-/m1/s1 |
| InChIKey | ZGFAMHOPGSLNQT-KVBJCFKZSA-N |
| XLogP | 7.61 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|