C30H45NO — CID 169312765
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-(6-ethyl-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169312765) has the molecular formula C30H45NO and a molecular weight of 435.70 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-(6-ethyl-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-(6-ethyl-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169312765 |
| Molecular Formula | C30H45NO |
| Molecular Weight | 435.70 g/mol |
| Exact Mass | 435.35 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-(6-ethyl-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCc1cccc(CC[C@@H](C)[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)n1 |
| InChI | InChI=1S/C30H45NO/c1-5-22-7-6-8-23(31-22)11-9-20(2)26-13-14-27-25-12-10-21-19-24(32)15-17-29(21,3)28(25)16-18-30(26,27)4/h6-8,10,20,24-28,32H,5,9,11-19H2,1-4H3/t20-,24+,25+,26-,27+,28+,29+,30-/m1/s1 |
| InChIKey | ZQELIQXHTQWPJG-LFFMLFRDSA-N |
| XLogP | 7.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.70 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|