C29H43NO — CID 169312912
(3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-4-pyridin-2-ylbutan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 169312912) has the molecular formula C29H43NO and a molecular weight of 421.67 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-4-pyridin-2-ylbutan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-4-pyridin-2-ylbutan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169312912 |
| Molecular Formula | C29H43NO |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.33 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-4-pyridin-2-ylbutan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCc1ccccn1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H43NO/c1-20(8-10-22-7-5-6-18-30-22)24-12-13-25-23-11-9-21-19-27(2,31)16-17-28(21,3)26(23)14-15-29(24,25)4/h5-7,9,18,20,23-26,31H,8,10-17,19H2,1-4H3/t20-,23+,24-,25+,26+,27+,28+,29-/m1/s1 |
| InChIKey | SDJJRZOSTAPLIM-HZEDMITCSA-N |
| XLogP | 6.98 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|