C34H42F3N5O3S — CID 169313337
(8R,22Z)-17-(1,1-dioxothian-4-yl)-2,2,32-trifluoro-8,25-dimethyl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16,22-octaen-18-one (PubChem CID 169313337) has the molecular formula C34H42F3N5O3S and a molecular weight of 657.80 g/mol. Its IUPAC name is (8R,22Z)-17-(1,1-dioxothian-4-yl)-2,2,32-trifluoro-8,25-dimethyl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16,22-octaen-18-one.
| Compound Name | (8R,22Z)-17-(1,1-dioxothian-4-yl)-2,2,32-trifluoro-8,25-dimethyl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16,22-octaen-18-one |
|---|---|
| PubChem CID | 169313337 |
| Molecular Formula | C34H42F3N5O3S |
| Molecular Weight | 657.80 g/mol |
| Exact Mass | 657.30 |
| IUPAC Name | (8R,22Z)-17-(1,1-dioxothian-4-yl)-2,2,32-trifluoro-8,25-dimethyl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16,22-octaen-18-one |
| SMILES | CC1C/C=C\CCn2c(=O)c(C3CCS(=O)(=O)CC3)cc3c(ncnc32)N[C@H](C)c2cccc(c2F)C(F)(F)C2CCN(CC2)C1 |
| InChI | InChI=1S/C34H42F3N5O3S/c1-22-7-4-3-5-14-42-32-28(19-27(33(42)43)24-12-17-46(44,45)18-13-24)31(38-21-39-32)40-23(2)26-8-6-9-29(30(26)35)34(36,37)25-10-15-41(20-22)16-11-25/h3-4,6,8-9,19,21-25H,5,7,10-18,20H2,1-2H3,(H,38,39,40)/b4-3-/t22?,23-/m1/s1 |
| InChIKey | HVFVPZPQTRDZDY-DITNNGEISA-N |
| XLogP | 6.19 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.80 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|