C32H39F3N6O3S — CID 169313385
(8R,21Z)-17-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2,25-trifluoro-8-methyl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16,21-octaen-18-one (PubChem CID 169313385) has the molecular formula C32H39F3N6O3S and a molecular weight of 644.76 g/mol. Its IUPAC name is (8R,21Z)-17-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2,25-trifluoro-8-methyl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16,21-octaen-18-one.
| Compound Name | (8R,21Z)-17-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2,25-trifluoro-8-methyl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16,21-octaen-18-one |
|---|---|
| PubChem CID | 169313385 |
| Molecular Formula | C32H39F3N6O3S |
| Molecular Weight | 644.76 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | (8R,21Z)-17-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2,25-trifluoro-8-methyl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16,21-octaen-18-one |
| SMILES | C[C@H]1Nc2ncnc3c2cc(N2CCS(=O)(=O)CC2)c(=O)n3C/C=C\CCC(F)CN2CCC(CC2)C(F)(F)c2cccc1c2 |
| InChI | InChI=1S/C32H39F3N6O3S/c1-22-23-6-5-7-25(18-23)32(34,35)24-9-12-39(13-10-24)20-26(33)8-3-2-4-11-41-30-27(29(38-22)36-21-37-30)19-28(31(41)42)40-14-16-45(43,44)17-15-40/h2,4-7,18-19,21-22,24,26H,3,8-17,20H2,1H3,(H,36,37,38)/b4-2-/t22-,26?/m1/s1 |
| InChIKey | KVUSWLVSIUJIHG-ZUKWBJFVSA-N |
| XLogP | 4.69 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.76 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|