C19H23FN2O2S — CID 16931345
2-(2-fluorophenoxy)-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)acetamide (PubChem CID 16931345) has the molecular formula C19H23FN2O2S and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 16931345 |
| Molecular Formula | C19H23FN2O2S |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)acetamide |
| SMILES | O=C(COc1ccccc1F)NCC(c1ccsc1)N1CCCCC1 |
| InChI | InChI=1S/C19H23FN2O2S/c20-16-6-2-3-7-18(16)24-13-19(23)21-12-17(15-8-11-25-14-15)22-9-4-1-5-10-22/h2-3,6-8,11,14,17H,1,4-5,9-10,12-13H2,(H,21,23) |
| InChIKey | NIEAPTOBQMWDOV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |