C32H42F2N6O2 — CID 169313540
(8R)-2,2-difluoro-8-methyl-17-morpholin-4-yl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16-heptaen-18-one (PubChem CID 169313540) has the molecular formula C32H42F2N6O2 and a molecular weight of 580.72 g/mol. Its IUPAC name is (8R)-2,2-difluoro-8-methyl-17-morpholin-4-yl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16-heptaen-18-one.
| Compound Name | (8R)-2,2-difluoro-8-methyl-17-morpholin-4-yl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16-heptaen-18-one |
|---|---|
| PubChem CID | 169313540 |
| Molecular Formula | C32H42F2N6O2 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | (8R)-2,2-difluoro-8-methyl-17-morpholin-4-yl-9,11,13,19,27-pentazapentacyclo[25.2.2.13,7.010,15.014,19]dotriaconta-3,5,7(32),10(15),11,13,16-heptaen-18-one |
| SMILES | C[C@H]1Nc2ncnc3c2cc(N2CCOCC2)c(=O)n3CCCCCCCN2CCC(CC2)C(F)(F)c2cccc1c2 |
| InChI | InChI=1S/C32H42F2N6O2/c1-23-24-8-7-9-26(20-24)32(33,34)25-10-14-38(15-11-25)12-5-3-2-4-6-13-40-30-27(29(37-23)35-22-36-30)21-28(31(40)41)39-16-18-42-19-17-39/h7-9,20-23,25H,2-6,10-19H2,1H3,(H,35,36,37)/t23-/m1/s1 |
| InChIKey | RGJRMWPOBVEQGX-HSZRJFAPSA-N |
| XLogP | 5.57 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |