C32H8F10N2S4 — CID 169313985
2,7-bis[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole (PubChem CID 169313985) has the molecular formula C32H8F10N2S4 and a molecular weight of 738.68 g/mol. Its IUPAC name is 2,7-bis[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole.
| Compound Name | 2,7-bis[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 169313985 |
| Molecular Formula | C32H8F10N2S4 |
| Molecular Weight | 738.68 g/mol |
| Exact Mass | 737.94 |
| IUPAC Name | 2,7-bis[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole |
| SMILES | Fc1c(F)c(F)c(-c2ccc(-c3nc4cc5cc6sc(-c7ccc(-c8c(F)c(F)c(F)c(F)c8F)s7)nc6cc5cc4s3)s2)c(F)c1F |
| InChI | InChI=1S/C32H8F10N2S4/c33-21-19(22(34)26(38)29(41)25(21)37)13-1-3-15(45-13)31-43-11-5-9-8-18-12(6-10(9)7-17(11)47-31)44-32(48-18)16-4-2-14(46-16)20-23(35)27(39)30(42)28(40)24(20)36/h1-8H |
| InChIKey | VQBLWMAJABXHPO-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.68 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|