C42H14F10N4O2S2 — CID 169313990
2,7-bis[4-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazol-5-yl]phenyl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole (PubChem CID 169313990) has the molecular formula C42H14F10N4O2S2 and a molecular weight of 860.71 g/mol. Its IUPAC name is 2,7-bis[4-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazol-5-yl]phenyl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole.
| Compound Name | 2,7-bis[4-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazol-5-yl]phenyl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 169313990 |
| Molecular Formula | C42H14F10N4O2S2 |
| Molecular Weight | 860.71 g/mol |
| Exact Mass | 860.04 |
| IUPAC Name | 2,7-bis[4-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazol-5-yl]phenyl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
| SMILES | Fc1c(F)c(F)c(-c2ncc(-c3ccc(-c4nc5cc6cc7oc(-c8ccc(-c9cnc(-c%10c(F)c(F)c(F)c(F)c%10F)s9)cc8)nc7cc6cc5o4)cc3)s2)c(F)c1F |
| InChI | InChI=1S/C42H14F10N4O2S2/c43-29-27(30(44)34(48)37(51)33(29)47)41-53-13-25(59-41)15-1-5-17(6-2-15)39-55-21-9-19-12-24-22(10-20(19)11-23(21)57-39)56-40(58-24)18-7-3-16(4-8-18)26-14-54-42(60-26)28-31(45)35(49)38(52)36(50)32(28)46/h1-14H |
| InChIKey | AFXMOVNMBHRQBE-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.71 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|