C30H10F2N4O2S6 — CID 169314005
2,7-bis[2-(5-fluorothieno[3,2-b]thiophen-2-yl)-1,3-thiazol-5-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole (PubChem CID 169314005) has the molecular formula C30H10F2N4O2S6 and a molecular weight of 688.83 g/mol. Its IUPAC name is 2,7-bis[2-(5-fluorothieno[3,2-b]thiophen-2-yl)-1,3-thiazol-5-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole.
| Compound Name | 2,7-bis[2-(5-fluorothieno[3,2-b]thiophen-2-yl)-1,3-thiazol-5-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 169314005 |
| Molecular Formula | C30H10F2N4O2S6 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 687.91 |
| IUPAC Name | 2,7-bis[2-(5-fluorothieno[3,2-b]thiophen-2-yl)-1,3-thiazol-5-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
| SMILES | Fc1cc2sc(-c3ncc(-c4nc5cc6cc7oc(-c8cnc(-c9cc%10sc(F)cc%10s9)s8)nc7cc6cc5o4)s3)cc2s1 |
| InChI | InChI=1S/C30H10F2N4O2S6/c31-25-7-19-17(41-25)5-21(39-19)29-33-9-23(43-29)27-35-13-1-11-3-16-14(2-12(11)4-15(13)37-27)36-28(38-16)24-10-34-30(44-24)22-6-18-20(40-22)8-26(32)42-18/h1-10H |
| InChIKey | ALRHVBHBVVGEBZ-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |