C32H8F8N4O2S4 — CID 169314022
[5-[7-[2-(2,3,4,5-tetrafluorobenzoyl)-1,3-thiazol-5-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-2-yl]-1,3-thiazol-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone (PubChem CID 169314022) has the molecular formula C32H8F8N4O2S4 and a molecular weight of 760.69 g/mol. Its IUPAC name is [5-[7-[2-(2,3,4,5-tetrafluorobenzoyl)-1,3-thiazol-5-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-2-yl]-1,3-thiazol-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone.
| Compound Name | [5-[7-[2-(2,3,4,5-tetrafluorobenzoyl)-1,3-thiazol-5-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-2-yl]-1,3-thiazol-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 169314022 |
| Molecular Formula | C32H8F8N4O2S4 |
| Molecular Weight | 760.69 g/mol |
| Exact Mass | 759.94 |
| IUPAC Name | [5-[7-[2-(2,3,4,5-tetrafluorobenzoyl)-1,3-thiazol-5-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazol-2-yl]-1,3-thiazol-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
| SMILES | O=C(c1ncc(-c2nc3cc4cc5sc(-c6cnc(C(=O)c7cc(F)c(F)c(F)c7F)s6)nc5cc4cc3s2)s1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C32H8F8N4O2S4/c33-13-5-11(21(35)25(39)23(13)37)27(45)31-41-7-19(49-31)29-43-15-1-9-3-18-16(2-10(9)4-17(15)47-29)44-30(48-18)20-8-42-32(50-20)28(46)12-6-14(34)24(38)26(40)22(12)36/h1-8H |
| InChIKey | RVBMJLVFMKVOPI-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.69 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|