C38H10F10N4S6 — CID 169314070
2,7-bis[5-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazol-5-yl]thiophen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole (PubChem CID 169314070) has the molecular formula C38H10F10N4S6 and a molecular weight of 904.91 g/mol. Its IUPAC name is 2,7-bis[5-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazol-5-yl]thiophen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole.
| Compound Name | 2,7-bis[5-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazol-5-yl]thiophen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 169314070 |
| Molecular Formula | C38H10F10N4S6 |
| Molecular Weight | 904.91 g/mol |
| Exact Mass | 903.91 |
| IUPAC Name | 2,7-bis[5-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazol-5-yl]thiophen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole |
| SMILES | Fc1c(F)c(F)c(-c2ncc(-c3ccc(-c4nc5cc6cc7sc(-c8ccc(-c9cnc(-c%10c(F)c(F)c(F)c(F)c%10F)s9)s8)nc7cc6cc5s4)s3)s2)c(F)c1F |
| InChI | InChI=1S/C38H10F10N4S6/c39-25-23(26(40)30(44)33(47)29(25)43)37-49-9-21(57-37)15-1-3-17(53-15)35-51-13-5-11-8-20-14(6-12(11)7-19(13)55-35)52-36(56-20)18-4-2-16(54-18)22-10-50-38(58-22)24-27(41)31(45)34(48)32(46)28(24)42/h1-10H |
| InChIKey | BUEXCJKPJOCMMX-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.91 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|