C34H10F6N4O2S4 — CID 169314089
2,7-bis[3,4-difluoro-5-(5-fluoro-1,3-benzothiazol-2-yl)thiophen-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole (PubChem CID 169314089) has the molecular formula C34H10F6N4O2S4 and a molecular weight of 748.74 g/mol. Its IUPAC name is 2,7-bis[3,4-difluoro-5-(5-fluoro-1,3-benzothiazol-2-yl)thiophen-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole.
| Compound Name | 2,7-bis[3,4-difluoro-5-(5-fluoro-1,3-benzothiazol-2-yl)thiophen-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 169314089 |
| Molecular Formula | C34H10F6N4O2S4 |
| Molecular Weight | 748.74 g/mol |
| Exact Mass | 747.96 |
| IUPAC Name | 2,7-bis[3,4-difluoro-5-(5-fluoro-1,3-benzothiazol-2-yl)thiophen-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
| SMILES | Fc1ccc2sc(-c3sc(-c4nc5cc6cc7oc(-c8sc(-c9nc%10cc(F)ccc%10s9)c(F)c8F)nc7cc6cc5o4)c(F)c3F)nc2c1 |
| InChI | InChI=1S/C34H10F6N4O2S4/c35-13-1-3-21-17(9-13)43-33(47-21)29-25(39)23(37)27(49-29)31-41-15-5-11-8-20-16(6-12(11)7-19(15)45-31)42-32(46-20)28-24(38)26(40)30(50-28)34-44-18-10-14(36)2-4-22(18)48-34/h1-10H |
| InChIKey | FXBJQIAIJNBXRD-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.74 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |