C38H18F2N4O2S2 — CID 169314110
2,7-bis(4-fluoro-5-quinolin-3-ylthiophen-2-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole (PubChem CID 169314110) has the molecular formula C38H18F2N4O2S2 and a molecular weight of 664.72 g/mol. Its IUPAC name is 2,7-bis(4-fluoro-5-quinolin-3-ylthiophen-2-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole.
| Compound Name | 2,7-bis(4-fluoro-5-quinolin-3-ylthiophen-2-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 169314110 |
| Molecular Formula | C38H18F2N4O2S2 |
| Molecular Weight | 664.72 g/mol |
| Exact Mass | 664.08 |
| IUPAC Name | 2,7-bis(4-fluoro-5-quinolin-3-ylthiophen-2-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
| SMILES | Fc1cc(-c2nc3cc4cc5oc(-c6cc(F)c(-c7cnc8ccccc8c7)s6)nc5cc4cc3o2)sc1-c1cnc2ccccc2c1 |
| InChI | InChI=1S/C38H18F2N4O2S2/c39-25-15-33(47-35(25)23-9-19-5-1-3-7-27(19)41-17-23)37-43-29-11-21-14-32-30(12-22(21)13-31(29)45-37)44-38(46-32)34-16-26(40)36(48-34)24-10-20-6-2-4-8-28(20)42-18-24/h1-18H |
| InChIKey | KYEHSOFLODOFJO-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.72 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |