C34H8F10N2O4S2 — CID 169314164
[5-[7-[5-(2,3,4,5,6-pentafluorobenzoyl)thiophen-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-2-yl]thiophen-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 169314164) has the molecular formula C34H8F10N2O4S2 and a molecular weight of 762.56 g/mol. Its IUPAC name is [5-[7-[5-(2,3,4,5,6-pentafluorobenzoyl)thiophen-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-2-yl]thiophen-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [5-[7-[5-(2,3,4,5,6-pentafluorobenzoyl)thiophen-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-2-yl]thiophen-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 169314164 |
| Molecular Formula | C34H8F10N2O4S2 |
| Molecular Weight | 762.56 g/mol |
| Exact Mass | 761.98 |
| IUPAC Name | [5-[7-[5-(2,3,4,5,6-pentafluorobenzoyl)thiophen-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-2-yl]thiophen-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(c1ccc(-c2nc3cc4cc5oc(-c6ccc(C(=O)c7c(F)c(F)c(F)c(F)c7F)s6)nc5cc4cc3o2)s1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C34H8F10N2O4S2/c35-21-19(22(36)26(40)29(43)25(21)39)31(47)15-1-3-17(51-15)33-45-11-5-9-8-14-12(6-10(9)7-13(11)49-33)46-34(50-14)18-4-2-16(52-18)32(48)20-23(37)27(41)30(44)28(42)24(20)38/h1-8H |
| InChIKey | OKYSIYLQNNKOFC-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.56 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|