C38H10F10N4S4 — CID 169314292
2,7-bis[6-(2,3,4,5,6-pentafluorophenyl)thieno[3,2-c]pyridin-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole (PubChem CID 169314292) has the molecular formula C38H10F10N4S4 and a molecular weight of 840.77 g/mol. Its IUPAC name is 2,7-bis[6-(2,3,4,5,6-pentafluorophenyl)thieno[3,2-c]pyridin-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole.
| Compound Name | 2,7-bis[6-(2,3,4,5,6-pentafluorophenyl)thieno[3,2-c]pyridin-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 169314292 |
| Molecular Formula | C38H10F10N4S4 |
| Molecular Weight | 840.77 g/mol |
| Exact Mass | 839.96 |
| IUPAC Name | 2,7-bis[6-(2,3,4,5,6-pentafluorophenyl)thieno[3,2-c]pyridin-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole |
| SMILES | Fc1c(F)c(F)c(-c2cc3sc(-c4nc5cc6cc7sc(-c8cc9cnc(-c%10c(F)c(F)c(F)c(F)c%10F)cc9s8)nc7cc6cc5s4)cc3cn2)c(F)c1F |
| InChI | InChI=1S/C38H10F10N4S4/c39-27-25(28(40)32(44)35(47)31(27)43)17-7-19-13(9-49-17)5-23(53-19)37-51-15-1-11-3-22-16(2-12(11)4-21(15)55-37)52-38(56-22)24-6-14-10-50-18(8-20(14)54-24)26-29(41)33(45)36(48)34(46)30(26)42/h1-10H |
| InChIKey | SHOAIXDOCVHQNK-UHFFFAOYSA-N |
| XLogP | 13.34 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.77 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|