C32H10F6N4O4S2 — CID 169314309
[2-[7-[5-(2,3,4-trifluorobenzoyl)-1,3-thiazol-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-2-yl]-1,3-thiazol-5-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 169314309) has the molecular formula C32H10F6N4O4S2 and a molecular weight of 692.58 g/mol. Its IUPAC name is [2-[7-[5-(2,3,4-trifluorobenzoyl)-1,3-thiazol-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-2-yl]-1,3-thiazol-5-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [2-[7-[5-(2,3,4-trifluorobenzoyl)-1,3-thiazol-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-2-yl]-1,3-thiazol-5-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 169314309 |
| Molecular Formula | C32H10F6N4O4S2 |
| Molecular Weight | 692.58 g/mol |
| Exact Mass | 692.00 |
| IUPAC Name | [2-[7-[5-(2,3,4-trifluorobenzoyl)-1,3-thiazol-2-yl]-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-2-yl]-1,3-thiazol-5-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1cnc(-c2nc3cc4cc5oc(-c6ncc(C(=O)c7ccc(F)c(F)c7F)s6)nc5cc4cc3o2)s1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C32H10F6N4O4S2/c33-15-3-1-13(23(35)25(15)37)27(43)21-9-39-31(47-21)29-41-17-5-11-8-20-18(6-12(11)7-19(17)45-29)42-30(46-20)32-40-10-22(48-32)28(44)14-2-4-16(34)26(38)24(14)36/h1-10H |
| InChIKey | HMOXPXGQIIORQX-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.58 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|