C40H20F2N2O2S2 — CID 169314311
2,7-bis[4-(6-fluoro-1-benzofuran-2-yl)phenyl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole (PubChem CID 169314311) has the molecular formula C40H20F2N2O2S2 and a molecular weight of 662.74 g/mol. Its IUPAC name is 2,7-bis[4-(6-fluoro-1-benzofuran-2-yl)phenyl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole.
| Compound Name | 2,7-bis[4-(6-fluoro-1-benzofuran-2-yl)phenyl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 169314311 |
| Molecular Formula | C40H20F2N2O2S2 |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 662.09 |
| IUPAC Name | 2,7-bis[4-(6-fluoro-1-benzofuran-2-yl)phenyl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole |
| SMILES | Fc1ccc2cc(-c3ccc(-c4nc5cc6cc7sc(-c8ccc(-c9cc%10ccc(F)cc%10o9)cc8)nc7cc6cc5s4)cc3)oc2c1 |
| InChI | InChI=1S/C40H20F2N2O2S2/c41-29-11-9-25-15-33(45-35(25)19-29)21-1-5-23(6-2-21)39-43-31-13-27-18-38-32(14-28(27)17-37(31)47-39)44-40(48-38)24-7-3-22(4-8-24)34-16-26-10-12-30(42)20-36(26)46-34/h1-20H |
| InChIKey | LBSMOSXPRUZFBR-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |