C23H29ClFN5O2S — CID 169314941
tert-butyl (4R,7S,8R,9R)-13-chloro-17-ethylsulfanyl-14-fluoro-9-methyl-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate (PubChem CID 169314941) has the molecular formula C23H29ClFN5O2S and a molecular weight of 494.04 g/mol. Its IUPAC name is tert-butyl (4R,7S,8R,9R)-13-chloro-17-ethylsulfanyl-14-fluoro-9-methyl-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate.
| Compound Name | tert-butyl (4R,7S,8R,9R)-13-chloro-17-ethylsulfanyl-14-fluoro-9-methyl-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate |
|---|---|
| PubChem CID | 169314941 |
| Molecular Formula | C23H29ClFN5O2S |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | tert-butyl (4R,7S,8R,9R)-13-chloro-17-ethylsulfanyl-14-fluoro-9-methyl-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene-20-carboxylate |
| SMILES | CCSc1nc2c3c(nc(Cl)c(F)c3n1)C[C@@H](C)[C@@H]1[C@@H]3CC[C@H](CN21)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H29ClFN5O2S/c1-6-33-21-27-17-15-13(26-19(24)16(17)25)9-11(2)18-14-8-7-12(10-29(18)20(15)28-21)30(14)22(31)32-23(3,4)5/h11-12,14,18H,6-10H2,1-5H3/t11-,12-,14+,18-/m1/s1 |
| InChIKey | IMNSQVIOBBAUEO-LSIMKLPESA-N |
| XLogP | 5.08 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|