C24H31ClFN5O2S — CID 169314978
tert-butyl (4R,7S,8S,9S,10R)-13-chloro-17-ethylsulfanyl-14-fluoro-9,10-dimethyl-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate (PubChem CID 169314978) has the molecular formula C24H31ClFN5O2S and a molecular weight of 508.06 g/mol. Its IUPAC name is tert-butyl (4R,7S,8S,9S,10R)-13-chloro-17-ethylsulfanyl-14-fluoro-9,10-dimethyl-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate.
| Compound Name | tert-butyl (4R,7S,8S,9S,10R)-13-chloro-17-ethylsulfanyl-14-fluoro-9,10-dimethyl-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate |
|---|---|
| PubChem CID | 169314978 |
| Molecular Formula | C24H31ClFN5O2S |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | tert-butyl (4R,7S,8S,9S,10R)-13-chloro-17-ethylsulfanyl-14-fluoro-9,10-dimethyl-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate |
| SMILES | CCSc1nc2c3c(nc(Cl)c(F)c3n1)[C@H](C)[C@H](C)[C@H]1[C@@H]3CC[C@H](CN21)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31ClFN5O2S/c1-7-34-22-28-18-15-17(27-20(25)16(18)26)11(2)12(3)19-14-9-8-13(10-30(19)21(15)29-22)31(14)23(32)33-24(4,5)6/h11-14,19H,7-10H2,1-6H3/t11-,12+,13-,14+,19+/m1/s1 |
| InChIKey | MZAXVVLKFFXDNE-YNORRXCFSA-N |
| XLogP | 5.64 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|