C14H24N2O2 — CID 169314984
tert-butyl (1S,2S,5R)-2-prop-2-enyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 169314984) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is tert-butyl (1S,2S,5R)-2-prop-2-enyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1S,2S,5R)-2-prop-2-enyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 169314984 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | tert-butyl (1S,2S,5R)-2-prop-2-enyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=CC[C@@H]1NC[C@H]2CC[C@@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O2/c1-5-6-11-12-8-7-10(9-15-11)16(12)13(17)18-14(2,3)4/h5,10-12,15H,1,6-9H2,2-4H3/t10-,11+,12+/m1/s1 |
| InChIKey | XSARICOOLGRAHD-WOPDTQHZSA-N |
| XLogP | 2.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|