C22H25ClF3N5O2S — CID 169314996
tert-butyl (4R,7S,8R)-13-chloro-17-ethylsulfanyl-10,10,14-trifluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate (PubChem CID 169314996) has the molecular formula C22H25ClF3N5O2S and a molecular weight of 515.99 g/mol. Its IUPAC name is tert-butyl (4R,7S,8R)-13-chloro-17-ethylsulfanyl-10,10,14-trifluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate.
| Compound Name | tert-butyl (4R,7S,8R)-13-chloro-17-ethylsulfanyl-10,10,14-trifluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate |
|---|---|
| PubChem CID | 169314996 |
| Molecular Formula | C22H25ClF3N5O2S |
| Molecular Weight | 515.99 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | tert-butyl (4R,7S,8R)-13-chloro-17-ethylsulfanyl-10,10,14-trifluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11,13,15(19),16-pentaene-20-carboxylate |
| SMILES | CCSc1nc2c3c(nc(Cl)c(F)c3n1)C(F)(F)C[C@@H]1[C@@H]3CC[C@H](CN21)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H25ClF3N5O2S/c1-5-34-19-27-15-13-16(28-17(23)14(15)24)22(25,26)8-12-11-7-6-10(9-30(12)18(13)29-19)31(11)20(32)33-21(2,3)4/h10-12H,5-9H2,1-4H3/t10-,11+,12-/m1/s1 |
| InChIKey | ULYZTTLYQXENSP-GRYCIOLGSA-N |
| XLogP | 5.38 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.99 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|