C24H31ClFN5O4S — CID 169315158
tert-butyl (4R,7S,8S,11R)-14-chloro-18-ethylsulfonyl-15-fluoro-11-methyl-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12,14,16(20),17-pentaene-21-carboxylate (PubChem CID 169315158) has the molecular formula C24H31ClFN5O4S and a molecular weight of 540.06 g/mol. Its IUPAC name is tert-butyl (4R,7S,8S,11R)-14-chloro-18-ethylsulfonyl-15-fluoro-11-methyl-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12,14,16(20),17-pentaene-21-carboxylate.
| Compound Name | tert-butyl (4R,7S,8S,11R)-14-chloro-18-ethylsulfonyl-15-fluoro-11-methyl-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12,14,16(20),17-pentaene-21-carboxylate |
|---|---|
| PubChem CID | 169315158 |
| Molecular Formula | C24H31ClFN5O4S |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | tert-butyl (4R,7S,8S,11R)-14-chloro-18-ethylsulfonyl-15-fluoro-11-methyl-2,13,17,19,21-pentazapentacyclo[10.7.1.14,7.02,8.016,20]henicosa-1(19),12,14,16(20),17-pentaene-21-carboxylate |
| SMILES | CCS(=O)(=O)c1nc2c3c(nc(Cl)c(F)c3n1)[C@H](C)CC[C@H]1[C@@H]3CC[C@H](CN21)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31ClFN5O4S/c1-6-36(33,34)22-28-19-16-18(27-20(25)17(19)26)12(2)7-9-14-15-10-8-13(11-30(14)21(16)29-22)31(15)23(32)35-24(3,4)5/h12-15H,6-11H2,1-5H3/t12-,13-,14+,15+/m1/s1 |
| InChIKey | QMRADGJLUBVLAG-KBXIAJHMSA-N |
| XLogP | 4.46 |
| TPSA | 105.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|