C14H18F3N3O2 — CID 169315359
[(3S,8S)-3-[[5-(trifluoromethyl)pyrazin-2-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (PubChem CID 169315359) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is [(3S,8S)-3-[[5-(trifluoromethyl)pyrazin-2-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol.
| Compound Name | [(3S,8S)-3-[[5-(trifluoromethyl)pyrazin-2-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 169315359 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [(3S,8S)-3-[[5-(trifluoromethyl)pyrazin-2-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| SMILES | OC[C@@]12CCCN1[C@H](COc1cnc(C(F)(F)F)cn1)CC2 |
| InChI | InChI=1S/C14H18F3N3O2/c15-14(16,17)11-6-19-12(7-18-11)22-8-10-2-4-13(9-21)3-1-5-20(10)13/h6-7,10,21H,1-5,8-9H2/t10-,13-/m0/s1 |
| InChIKey | SUZWCURZIYNWFS-GWCFXTLKSA-N |
| XLogP | 1.86 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |