C9H14F3NO2 — CID 169315423
[(2S,8S)-2-(trifluoromethoxy)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (PubChem CID 169315423) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is [(2S,8S)-2-(trifluoromethoxy)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol.
| Compound Name | [(2S,8S)-2-(trifluoromethoxy)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 169315423 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | [(2S,8S)-2-(trifluoromethoxy)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| SMILES | OC[C@@]12CCCN1C[C@@H](OC(F)(F)F)C2 |
| InChI | InChI=1S/C9H14F3NO2/c10-9(11,12)15-7-4-8(6-14)2-1-3-13(8)5-7/h7,14H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | KQTKRJOHEQAXRV-YUMQZZPRSA-N |
| XLogP | 1.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |