C28H30FNO — CID 169315450
(3S,8S)-3-(fluoromethyl)-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 169315450) has the molecular formula C28H30FNO and a molecular weight of 415.55 g/mol. Its IUPAC name is (3S,8S)-3-(fluoromethyl)-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (3S,8S)-3-(fluoromethyl)-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 169315450 |
| Molecular Formula | C28H30FNO |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | (3S,8S)-3-(fluoromethyl)-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | FC[C@@H]1CC[C@]2(COC(c3ccccc3)(c3ccccc3)c3ccccc3)CCCN12 |
| InChI | InChI=1S/C28H30FNO/c29-21-26-17-19-27(18-10-20-30(26)27)22-31-28(23-11-4-1-5-12-23,24-13-6-2-7-14-24)25-15-8-3-9-16-25/h1-9,11-16,26H,10,17-22H2/t26-,27-/m0/s1 |
| InChIKey | PROKJTUKKIIRIH-SVBPBHIXSA-N |
| XLogP | 5.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|