C14H14F9NO4 — CID 169315532
ethyl (2R,8R)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate (PubChem CID 169315532) has the molecular formula C14H14F9NO4 and a molecular weight of 431.25 g/mol. Its IUPAC name is ethyl (2R,8R)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate.
| Compound Name | ethyl (2R,8R)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 169315532 |
| Molecular Formula | C14H14F9NO4 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | ethyl (2R,8R)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
| SMILES | CCOC(=O)[C@]12CCC(=O)N1C[C@H](OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C14H14F9NO4/c1-2-27-9(26)10-4-3-8(25)24(10)6-7(5-10)28-11(12(15,16)17,13(18,19)20)14(21,22)23/h7H,2-6H2,1H3/t7-,10-/m1/s1 |
| InChIKey | IHADERQILFJYQE-GMSGAONNSA-N |
| XLogP | 3.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |