C30H32F3NO2 — CID 169315680
(3S,8S)-3-(2,2,2-trifluoroethoxymethyl)-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 169315680) has the molecular formula C30H32F3NO2 and a molecular weight of 495.59 g/mol. Its IUPAC name is (3S,8S)-3-(2,2,2-trifluoroethoxymethyl)-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (3S,8S)-3-(2,2,2-trifluoroethoxymethyl)-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 169315680 |
| Molecular Formula | C30H32F3NO2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (3S,8S)-3-(2,2,2-trifluoroethoxymethyl)-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | FC(F)(F)COC[C@@H]1CC[C@]2(COC(c3ccccc3)(c3ccccc3)c3ccccc3)CCCN12 |
| InChI | InChI=1S/C30H32F3NO2/c31-29(32,33)23-35-21-27-17-19-28(18-10-20-34(27)28)22-36-30(24-11-4-1-5-12-24,25-13-6-2-7-14-25)26-15-8-3-9-16-26/h1-9,11-16,27H,10,17-23H2/t27-,28-/m0/s1 |
| InChIKey | PWRGFLJJUVFFOJ-NSOVKSMOSA-N |
| XLogP | 6.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|