C18H26N2O7S — CID 169316324
[(3E,15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-3-en-15-yl] propanoate (PubChem CID 169316324) has the molecular formula C18H26N2O7S and a molecular weight of 414.48 g/mol. Its IUPAC name is [(3E,15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-3-en-15-yl] propanoate.
| Compound Name | [(3E,15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-3-en-15-yl] propanoate |
|---|---|
| PubChem CID | 169316324 |
| Molecular Formula | C18H26N2O7S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [(3E,15R)-16,16-dimethyl-2,5,10,14-tetraoxo-1-oxa-6-thia-9,13-diazacycloheptadec-3-en-15-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1C(=O)NCCC(=O)NCCSC(=O)/C=C/C(=O)OCC1(C)C |
| InChI | InChI=1S/C18H26N2O7S/c1-4-13(22)27-16-17(25)20-8-7-12(21)19-9-10-28-15(24)6-5-14(23)26-11-18(16,2)3/h5-6,16H,4,7-11H2,1-3H3,(H,19,21)(H,20,25)/b6-5+/t16-/m0/s1 |
| InChIKey | FCSPUWYMBNFRHG-JFDDCEBESA-N |
| XLogP | 0.33 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|