C22H32N2O10S — CID 169316327
1-O-methyl 4-O-[2-methyl-2-[(2R)-3,7,12,14,17-pentaoxo-1-oxa-11-thia-4,8-diazacycloheptadec-2-yl]propyl] butanedioate (PubChem CID 169316327) has the molecular formula C22H32N2O10S and a molecular weight of 516.57 g/mol. Its IUPAC name is 1-O-methyl 4-O-[2-methyl-2-[(2R)-3,7,12,14,17-pentaoxo-1-oxa-11-thia-4,8-diazacycloheptadec-2-yl]propyl] butanedioate.
| Compound Name | 1-O-methyl 4-O-[2-methyl-2-[(2R)-3,7,12,14,17-pentaoxo-1-oxa-11-thia-4,8-diazacycloheptadec-2-yl]propyl] butanedioate |
|---|---|
| PubChem CID | 169316327 |
| Molecular Formula | C22H32N2O10S |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 1-O-methyl 4-O-[2-methyl-2-[(2R)-3,7,12,14,17-pentaoxo-1-oxa-11-thia-4,8-diazacycloheptadec-2-yl]propyl] butanedioate |
| SMILES | COC(=O)CCC(=O)OCC(C)(C)[C@H]1OC(=O)CCC(=O)CC(=O)SCCNC(=O)CCNC1=O |
| InChI | InChI=1S/C22H32N2O10S/c1-22(2,13-33-17(28)7-6-16(27)32-3)20-21(31)24-9-8-15(26)23-10-11-35-19(30)12-14(25)4-5-18(29)34-20/h20H,4-13H2,1-3H3,(H,23,26)(H,24,31)/t20-/m0/s1 |
| InChIKey | VSELNGPXGQPHCW-FQEVSTJZSA-N |
| XLogP | 0.06 |
| TPSA | 171.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|