C23H36N3O9S+ — CID 169316332
trimethyl-[2-[(E)-4-[2-methyl-2-[(2R)-3,7,12,14-tetraoxo-1-oxa-11-thia-4,8-diazacyclotetradec-2-yl]propoxy]-4-oxobut-2-enoyl]oxyethyl]azanium (PubChem CID 169316332) has the molecular formula C23H36N3O9S+ and a molecular weight of 530.62 g/mol. Its IUPAC name is trimethyl-[2-[(E)-4-[2-methyl-2-[(2R)-3,7,12,14-tetraoxo-1-oxa-11-thia-4,8-diazacyclotetradec-2-yl]propoxy]-4-oxobut-2-enoyl]oxyethyl]azanium.
| Compound Name | trimethyl-[2-[(E)-4-[2-methyl-2-[(2R)-3,7,12,14-tetraoxo-1-oxa-11-thia-4,8-diazacyclotetradec-2-yl]propoxy]-4-oxobut-2-enoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 169316332 |
| Molecular Formula | C23H36N3O9S+ |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | trimethyl-[2-[(E)-4-[2-methyl-2-[(2R)-3,7,12,14-tetraoxo-1-oxa-11-thia-4,8-diazacyclotetradec-2-yl]propoxy]-4-oxobut-2-enoyl]oxyethyl]azanium |
| SMILES | CC(C)(COC(=O)/C=C/C(=O)OCC[N+](C)(C)C)[C@H]1OC(=O)CC(=O)SCCNC(=O)CCNC1=O |
| InChI | InChI=1S/C23H35N3O9S/c1-23(2,15-34-18(29)7-6-17(28)33-12-11-26(3,4)5)21-22(32)25-9-8-16(27)24-10-13-36-20(31)14-19(30)35-21/h6-7,21H,8-15H2,1-5H3,(H-,24,25,27,32)/p+1/b7-6+/t21-/m0/s1 |
| InChIKey | PGVOJRJBVNHSCK-BXKJMJEDSA-O |
| XLogP | -0.44 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|