C16H22N2O8S — CID 169316339
(E)-4-[[(12R)-13,13-dimethyl-2,7,11-trioxo-1-oxa-3-thia-6,10-diazacyclotetradec-12-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 169316339) has the molecular formula C16H22N2O8S and a molecular weight of 402.43 g/mol. Its IUPAC name is (E)-4-[[(12R)-13,13-dimethyl-2,7,11-trioxo-1-oxa-3-thia-6,10-diazacyclotetradec-12-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[(12R)-13,13-dimethyl-2,7,11-trioxo-1-oxa-3-thia-6,10-diazacyclotetradec-12-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 169316339 |
| Molecular Formula | C16H22N2O8S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (E)-4-[[(12R)-13,13-dimethyl-2,7,11-trioxo-1-oxa-3-thia-6,10-diazacyclotetradec-12-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | CC1(C)COC(=O)SCCNC(=O)CCNC(=O)[C@@H]1OC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H22N2O8S/c1-16(2)9-25-15(24)27-8-7-17-10(19)5-6-18-14(23)13(16)26-12(22)4-3-11(20)21/h3-4,13H,5-9H2,1-2H3,(H,17,19)(H,18,23)(H,20,21)/b4-3+/t13-/m0/s1 |
| InChIKey | CECKWHMVXPAXLH-OOPCZODUSA-N |
| XLogP | 0.07 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|