C18H24N2O9S — CID 169316350
(E)-4-[2-methyl-2-[(2R)-3,7,12,14-tetraoxo-1-oxa-11-thia-4,8-diazacyclotetradec-2-yl]propoxy]-4-oxobut-2-enoic acid (PubChem CID 169316350) has the molecular formula C18H24N2O9S and a molecular weight of 444.46 g/mol. Its IUPAC name is (E)-4-[2-methyl-2-[(2R)-3,7,12,14-tetraoxo-1-oxa-11-thia-4,8-diazacyclotetradec-2-yl]propoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-methyl-2-[(2R)-3,7,12,14-tetraoxo-1-oxa-11-thia-4,8-diazacyclotetradec-2-yl]propoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 169316350 |
| Molecular Formula | C18H24N2O9S |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | (E)-4-[2-methyl-2-[(2R)-3,7,12,14-tetraoxo-1-oxa-11-thia-4,8-diazacyclotetradec-2-yl]propoxy]-4-oxobut-2-enoic acid |
| SMILES | CC(C)(COC(=O)/C=C/C(=O)O)[C@H]1OC(=O)CC(=O)SCCNC(=O)CCNC1=O |
| InChI | InChI=1S/C18H24N2O9S/c1-18(2,10-28-13(24)4-3-12(22)23)16-17(27)20-6-5-11(21)19-7-8-30-15(26)9-14(25)29-16/h3-4,16H,5-10H2,1-2H3,(H,19,21)(H,20,27)(H,22,23)/b4-3+/t16-/m0/s1 |
| InChIKey | PCGQVUBEUDMQEQ-CWDCEQMOSA-N |
| XLogP | -0.61 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|