C26H40N3O10S+ — CID 169316355
trimethyl-[2-[(E)-4-[2-methyl-2-[(2R)-3,7,12,14,17-pentaoxo-1-oxa-11-thia-4,8-diazacycloheptadec-2-yl]propoxy]-4-oxobut-2-enoyl]oxyethyl]azanium (PubChem CID 169316355) has the molecular formula C26H40N3O10S+ and a molecular weight of 586.68 g/mol. Its IUPAC name is trimethyl-[2-[(E)-4-[2-methyl-2-[(2R)-3,7,12,14,17-pentaoxo-1-oxa-11-thia-4,8-diazacycloheptadec-2-yl]propoxy]-4-oxobut-2-enoyl]oxyethyl]azanium.
| Compound Name | trimethyl-[2-[(E)-4-[2-methyl-2-[(2R)-3,7,12,14,17-pentaoxo-1-oxa-11-thia-4,8-diazacycloheptadec-2-yl]propoxy]-4-oxobut-2-enoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 169316355 |
| Molecular Formula | C26H40N3O10S+ |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | trimethyl-[2-[(E)-4-[2-methyl-2-[(2R)-3,7,12,14,17-pentaoxo-1-oxa-11-thia-4,8-diazacycloheptadec-2-yl]propoxy]-4-oxobut-2-enoyl]oxyethyl]azanium |
| SMILES | CC(C)(COC(=O)/C=C/C(=O)OCC[N+](C)(C)C)[C@H]1OC(=O)CCC(=O)CC(=O)SCCNC(=O)CCNC1=O |
| InChI | InChI=1S/C26H39N3O10S/c1-26(2,17-38-21(33)9-8-20(32)37-14-13-29(3,4)5)24-25(36)28-11-10-19(31)27-12-15-40-23(35)16-18(30)6-7-22(34)39-24/h8-9,24H,6-7,10-17H2,1-5H3,(H-,27,28,31,36)/p+1/b9-8+/t24-/m0/s1 |
| InChIKey | YMLNAJKSWPFNGD-KDLSMAQYSA-O |
| XLogP | -0.09 |
| TPSA | 171.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|